C13H17ClO3 — CID 125472694
1-[2-[(2R)-3-chloro-2-hydroxypropoxy]-4,6-dimethylphenyl]ethanone (PubChem CID 125472694) has the molecular formula C13H17ClO3 and a molecular weight of 256.73 g/mol. Its IUPAC name is 1-[2-[(2R)-3-chloro-2-hydroxypropoxy]-4,6-dimethylphenyl]ethanone.
| Compound Name | 1-[2-[(2R)-3-chloro-2-hydroxypropoxy]-4,6-dimethylphenyl]ethanone |
|---|---|
| PubChem CID | 125472694 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-[2-[(2R)-3-chloro-2-hydroxypropoxy]-4,6-dimethylphenyl]ethanone |
| SMILES | CC(=O)c1c(C)cc(C)cc1OC[C@@H](O)CCl |
| InChI | InChI=1S/C13H17ClO3/c1-8-4-9(2)13(10(3)15)12(5-8)17-7-11(16)6-14/h4-5,11,16H,6-7H2,1-3H3/t11-/m0/s1 |
| InChIKey | QNYWLDLJKSNHNO-NSHDSACASA-N |
| XLogP | 2.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|