C16H25NO2 — CID 106681678
7-amino-1-(2-methoxy-4,6-dimethylphenyl)heptan-1-one (PubChem CID 106681678) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is 7-amino-1-(2-methoxy-4,6-dimethylphenyl)heptan-1-one.
| Compound Name | 7-amino-1-(2-methoxy-4,6-dimethylphenyl)heptan-1-one |
|---|---|
| PubChem CID | 106681678 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 7-amino-1-(2-methoxy-4,6-dimethylphenyl)heptan-1-one |
| SMILES | COc1cc(C)cc(C)c1C(=O)CCCCCCN |
| InChI | InChI=1S/C16H25NO2/c1-12-10-13(2)16(15(11-12)19-3)14(18)8-6-4-5-7-9-17/h10-11H,4-9,17H2,1-3H3 |
| InChIKey | VCAHGZSMBVMCNS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|