C18H25N3O3 — CID 57317823
1-(2,3-diamino-5-methylphenoxy)-3-(2-phenoxyethylamino)propan-2-ol (PubChem CID 57317823) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-(2,3-diamino-5-methylphenoxy)-3-(2-phenoxyethylamino)propan-2-ol.
| Compound Name | 1-(2,3-diamino-5-methylphenoxy)-3-(2-phenoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 57317823 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-(2,3-diamino-5-methylphenoxy)-3-(2-phenoxyethylamino)propan-2-ol |
| SMILES | Cc1cc(N)c(N)c(OCC(O)CNCCOc2ccccc2)c1 |
| InChI | InChI=1S/C18H25N3O3/c1-13-9-16(19)18(20)17(10-13)24-12-14(22)11-21-7-8-23-15-5-3-2-4-6-15/h2-6,9-10,14,21-22H,7-8,11-12,19-20H2,1H3 |
| InChIKey | MMNQUHHKVUMMFW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|