C18H23F2N3O4S — CID 67250300
N-[4-[(2R)-3-[2-(3,4-difluoroanilino)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide (PubChem CID 67250300) has the molecular formula C18H23F2N3O4S and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[4-[(2R)-3-[2-(3,4-difluoroanilino)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(2R)-3-[2-(3,4-difluoroanilino)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67250300 |
| Molecular Formula | C18H23F2N3O4S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[4-[(2R)-3-[2-(3,4-difluoroanilino)ethylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OC[C@H](O)CNCCNc2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H23F2N3O4S/c1-28(25,26)23-13-2-5-16(6-3-13)27-12-15(24)11-21-8-9-22-14-4-7-17(19)18(20)10-14/h2-7,10,15,21-24H,8-9,11-12H2,1H3/t15-/m1/s1 |
| InChIKey | AXLFTJXYZXBURY-OAHLLOKOSA-N |
| XLogP | 1.78 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|