C19H22Cl2N2O4S — CID 67252555
N-[4-[(2R)-3-[3-(3,4-dichlorophenyl)prop-2-enylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide (PubChem CID 67252555) has the molecular formula C19H22Cl2N2O4S and a molecular weight of 445.37 g/mol. Its IUPAC name is N-[4-[(2R)-3-[3-(3,4-dichlorophenyl)prop-2-enylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(2R)-3-[3-(3,4-dichlorophenyl)prop-2-enylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 67252555 |
| Molecular Formula | C19H22Cl2N2O4S |
| Molecular Weight | 445.37 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | N-[4-[(2R)-3-[3-(3,4-dichlorophenyl)prop-2-enylamino]-2-hydroxypropoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OC[C@H](O)CNCC=Cc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C19H22Cl2N2O4S/c1-28(25,26)23-15-5-7-17(8-6-15)27-13-16(24)12-22-10-2-3-14-4-9-18(20)19(21)11-14/h2-9,11,16,22-24H,10,12-13H2,1H3/t16-/m1/s1 |
| InChIKey | RNUJWCFAKZRXED-MRXNPFEDSA-N |
| XLogP | 3.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|