C20H23Cl2NO4S — CID 123344745
CID 123344745 (PubChem CID 123344745) has the molecular formula C20H23Cl2NO4S and a molecular weight of 444.38 g/mol.
| Compound Name | CID 123344745 |
|---|---|
| PubChem CID | 123344745 |
| Molecular Formula | C20H23Cl2NO4S |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | — |
| SMILES | Cc1ccc(OCC(O)CCC/C=C/c2ccc(Cl)c(Cl)c2)cc1.N=S(=O)=O |
| InChI | InChI=1S/C20H22Cl2O2.HNO2S/c1-15-7-10-18(11-8-15)24-14-17(23)6-4-2-3-5-16-9-12-19(21)20(22)13-16;1-4(2)3/h3,5,7-13,17,23H,2,4,6,14H2,1H3;1H/b5-3+; |
| InChIKey | CMUNYGGFNQQUNU-WGCWOXMQSA-N |
| XLogP | 5.55 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|