C21H25ClO2 — CID 58329061
(E)-7-(4-chloro-3-methylphenyl)-1-(4-methylphenoxy)hept-6-en-2-ol (PubChem CID 58329061) has the molecular formula C21H25ClO2 and a molecular weight of 344.88 g/mol. Its IUPAC name is (E)-7-(4-chloro-3-methylphenyl)-1-(4-methylphenoxy)hept-6-en-2-ol.
| Compound Name | (E)-7-(4-chloro-3-methylphenyl)-1-(4-methylphenoxy)hept-6-en-2-ol |
|---|---|
| PubChem CID | 58329061 |
| Molecular Formula | C21H25ClO2 |
| Molecular Weight | 344.88 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | (E)-7-(4-chloro-3-methylphenyl)-1-(4-methylphenoxy)hept-6-en-2-ol |
| SMILES | Cc1ccc(OCC(O)CCC/C=C/c2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C21H25ClO2/c1-16-8-11-20(12-9-16)24-15-19(23)7-5-3-4-6-18-10-13-21(22)17(2)14-18/h4,6,8-14,19,23H,3,5,7,15H2,1-2H3/b6-4+ |
| InChIKey | RXPGJLCLHATVRF-GQCTYLIASA-N |
| XLogP | 5.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.88 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|