C26H37N5O11S — CID 110168560
N-[3-[3-[[2-hydroxy-3-(4-nitrophenoxy)propyl]amino]propyl-methylamino]propyl]-4-(methanesulfonamido)benzamide;oxalic acid (PubChem CID 110168560) has the molecular formula C26H37N5O11S and a molecular weight of 627.67 g/mol. Its IUPAC name is N-[3-[3-[[2-hydroxy-3-(4-nitrophenoxy)propyl]amino]propyl-methylamino]propyl]-4-(methanesulfonamido)benzamide;oxalic acid.
| Compound Name | N-[3-[3-[[2-hydroxy-3-(4-nitrophenoxy)propyl]amino]propyl-methylamino]propyl]-4-(methanesulfonamido)benzamide;oxalic acid |
|---|---|
| PubChem CID | 110168560 |
| Molecular Formula | C26H37N5O11S |
| Molecular Weight | 627.67 g/mol |
| Exact Mass | 627.22 |
| IUPAC Name | N-[3-[3-[[2-hydroxy-3-(4-nitrophenoxy)propyl]amino]propyl-methylamino]propyl]-4-(methanesulfonamido)benzamide;oxalic acid |
| SMILES | CN(CCCNCC(O)COc1ccc([N+](=O)[O-])cc1)CCCNC(=O)c1ccc(NS(C)(=O)=O)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H35N5O7S.C2H2O4/c1-28(16-4-14-26-24(31)19-5-7-20(8-6-19)27-37(2,34)35)15-3-13-25-17-22(30)18-36-23-11-9-21(10-12-23)29(32)33;3-1(4)2(5)6/h5-12,22,25,27,30H,3-4,13-18H2,1-2H3,(H,26,31);(H,3,4)(H,5,6) |
| InChIKey | MPZAJEYOEGFUQY-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 237.74 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.67 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|