C25H29NO6P+ — CID 67683856
hydroxy-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]-2-(phenoxymethyl)phenyl]-oxophosphanium (PubChem CID 67683856) has the molecular formula C25H29NO6P+ and a molecular weight of 470.48 g/mol. Its IUPAC name is hydroxy-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]-2-(phenoxymethyl)phenyl]-oxophosphanium.
| Compound Name | hydroxy-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]-2-(phenoxymethyl)phenyl]-oxophosphanium |
|---|---|
| PubChem CID | 67683856 |
| Molecular Formula | C25H29NO6P+ |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | hydroxy-[4-[2-[[2-hydroxy-3-(4-hydroxyphenoxy)propyl]amino]propyl]-2-(phenoxymethyl)phenyl]-oxophosphanium |
| SMILES | CC(Cc1ccc([P+](=O)O)c(COc2ccccc2)c1)NCC(O)COc1ccc(O)cc1 |
| InChI | InChI=1S/C25H28NO6P/c1-18(26-15-22(28)17-32-24-10-8-21(27)9-11-24)13-19-7-12-25(33(29)30)20(14-19)16-31-23-5-3-2-4-6-23/h2-12,14,18,22,26,28H,13,15-17H2,1H3,(H-,27,29,30)/p+1 |
| InChIKey | ALUPMKJAIMTDTO-UHFFFAOYSA-O |
| XLogP | 3.29 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|