C19H22ClN5O2 — CID 138961166
1-[(4-chlorophenyl)methoxy]-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol (PubChem CID 138961166) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methoxy]-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol.
| Compound Name | 1-[(4-chlorophenyl)methoxy]-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 138961166 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[(4-chlorophenyl)methoxy]-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol |
| SMILES | CC(NCC(O)COCc1ccc(Cl)cc1)c1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-14(16-4-8-18(9-5-16)25-13-22-23-24-25)21-10-19(26)12-27-11-15-2-6-17(20)7-3-15/h2-9,13-14,19,21,26H,10-12H2,1H3 |
| InChIKey | YXAXKYDJMKHQQW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |