C22H32ClN5O2 — CID 138961145
1-(1-adamantyloxy)-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol;hydrochloride (PubChem CID 138961145) has the molecular formula C22H32ClN5O2 and a molecular weight of 433.98 g/mol. Its IUPAC name is 1-(1-adamantyloxy)-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-(1-adamantyloxy)-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138961145 |
| Molecular Formula | C22H32ClN5O2 |
| Molecular Weight | 433.98 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-(1-adamantyloxy)-3-[1-[4-(tetrazol-1-yl)phenyl]ethylamino]propan-2-ol;hydrochloride |
| SMILES | CC(NCC(O)COC12CC3CC(CC(C3)C1)C2)c1ccc(-n2cnnn2)cc1.Cl |
| InChI | InChI=1S/C22H31N5O2.ClH/c1-15(19-2-4-20(5-3-19)27-14-24-25-26-27)23-12-21(28)13-29-22-9-16-6-17(10-22)8-18(7-16)11-22;/h2-5,14-18,21,23,28H,6-13H2,1H3;1H |
| InChIKey | CWGOUPKDCFLNRN-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.98 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |