C19H19Cl5N2O3 — CID 25107496
2,2,2-trichloro-N-[4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]acetamide (PubChem CID 25107496) has the molecular formula C19H19Cl5N2O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 25107496 |
| Molecular Formula | C19H19Cl5N2O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(2S)-3-[2-(3,4-dichlorophenyl)ethylamino]-2-hydroxypropoxy]phenyl]acetamide |
| SMILES | O=C(Nc1ccc(OC[C@@H](O)CNCCc2ccc(Cl)c(Cl)c2)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H19Cl5N2O3/c20-16-6-1-12(9-17(16)21)7-8-25-10-14(27)11-29-15-4-2-13(3-5-15)26-18(28)19(22,23)24/h1-6,9,14,25,27H,7-8,10-11H2,(H,26,28)/t14-/m0/s1 |
| InChIKey | UGUJDVLOQFWGMK-AWEZNQCLSA-N |
| XLogP | 4.87 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|