C19H26ClNO2 — CID 117067234
1-(3-methylphenoxy)-3-(3-phenylpropylamino)propan-2-ol;hydrochloride (PubChem CID 117067234) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-(3-methylphenoxy)-3-(3-phenylpropylamino)propan-2-ol;hydrochloride.
| Compound Name | 1-(3-methylphenoxy)-3-(3-phenylpropylamino)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 117067234 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-(3-methylphenoxy)-3-(3-phenylpropylamino)propan-2-ol;hydrochloride |
| SMILES | Cc1cccc(OCC(O)CNCCCc2ccccc2)c1.Cl |
| InChI | InChI=1S/C19H25NO2.ClH/c1-16-7-5-11-19(13-16)22-15-18(21)14-20-12-6-10-17-8-3-2-4-9-17;/h2-5,7-9,11,13,18,20-21H,6,10,12,14-15H2,1H3;1H |
| InChIKey | BURBFRABKUOHEF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|