C22H22N2O5 — CID 18660897
(2S)-1-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethylamino]-3-phenoxypropan-2-ol (PubChem CID 18660897) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is (2S)-1-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethylamino]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethylamino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 18660897 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | (2S)-1-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethylamino]-3-phenoxypropan-2-ol |
| SMILES | O[C@@H](CNCCOc1ccc2cc(-c3ccon3)oc2c1)COc1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c25-17(15-27-18-4-2-1-3-5-18)14-23-9-11-26-19-7-6-16-12-22(29-21(16)13-19)20-8-10-28-24-20/h1-8,10,12-13,17,23,25H,9,11,14-15H2/t17-/m0/s1 |
| InChIKey | NMPKMVWBWQLJKM-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 89.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|