C13H12N2O3 — CID 141070530
2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethanamine (PubChem CID 141070530) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethanamine.
| Compound Name | 2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethanamine |
|---|---|
| PubChem CID | 141070530 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-6-yl]oxy]ethanamine |
| SMILES | NCCOc1ccc2cc(-c3ccon3)oc2c1 |
| InChI | InChI=1S/C13H12N2O3/c14-4-6-16-10-2-1-9-7-13(18-12(9)8-10)11-3-5-17-15-11/h1-3,5,7-8H,4,6,14H2 |
| InChIKey | ARNWYYKGQBHHTR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |