C12H16N2O2 — CID 69274959
N'-[2-(1-benzofuran-5-yloxy)ethyl]ethane-1,2-diamine (PubChem CID 69274959) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N'-[2-(1-benzofuran-5-yloxy)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(1-benzofuran-5-yloxy)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 69274959 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N'-[2-(1-benzofuran-5-yloxy)ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCOc1ccc2occc2c1 |
| InChI | InChI=1S/C12H16N2O2/c13-4-5-14-6-8-15-11-1-2-12-10(9-11)3-7-16-12/h1-3,7,9,14H,4-6,8,13H2 |
| InChIKey | LNBIXKKIAYQHII-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|