C22H32O8 — CID 166517515
(3R,4S,5R,6R)-4-[8-(1-benzofuran-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol (PubChem CID 166517515) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-[8-(1-benzofuran-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-4-[8-(1-benzofuran-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 166517515 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (3R,4S,5R,6R)-4-[8-(1-benzofuran-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H](OCCCCCCCCOc2ccc3occc3c2)[C@@H]1O |
| InChI | InChI=1S/C22H32O8/c23-14-18-19(24)21(20(25)22(26)30-18)29-11-6-4-2-1-3-5-10-27-16-7-8-17-15(13-16)9-12-28-17/h7-9,12-13,18-26H,1-6,10-11,14H2/t18-,19-,20-,21+,22?/m1/s1 |
| InChIKey | CUMAFRGVCBFXJP-WMDDLZNTSA-N |
| XLogP | 1.97 |
| TPSA | 121.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|