C21H26O9 — CID 166517530
3-naphthalen-2-yloxypropyl 2-[(3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate (PubChem CID 166517530) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is 3-naphthalen-2-yloxypropyl 2-[(3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate.
| Compound Name | 3-naphthalen-2-yloxypropyl 2-[(3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate |
|---|---|
| PubChem CID | 166517530 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 3-naphthalen-2-yloxypropyl 2-[(3R,4S,5R,6R)-2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxyacetate |
| SMILES | O=C(CO[C@H]1[C@H](O)[C@@H](CO)OC(O)[C@@H]1O)OCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H26O9/c22-11-16-18(24)20(19(25)21(26)30-16)29-12-17(23)28-9-3-8-27-15-7-6-13-4-1-2-5-14(13)10-15/h1-2,4-7,10,16,18-22,24-26H,3,8-9,11-12H2/t16-,18-,19-,20+,21?/m1/s1 |
| InChIKey | AOZJRPVLSWCQRY-CTLHLVSWSA-N |
| XLogP | -0.03 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|