C21H32O9 — CID 166517579
(3R,4S,5R,6R)-4-[8-(1,3-benzodioxol-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol (PubChem CID 166517579) has the molecular formula C21H32O9 and a molecular weight of 428.48 g/mol. Its IUPAC name is (3R,4S,5R,6R)-4-[8-(1,3-benzodioxol-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-4-[8-(1,3-benzodioxol-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 166517579 |
| Molecular Formula | C21H32O9 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | (3R,4S,5R,6R)-4-[8-(1,3-benzodioxol-5-yloxy)octoxy]-6-(hydroxymethyl)oxane-2,3,5-triol |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H](OCCCCCCCCOc2ccc3c(c2)OCO3)[C@@H]1O |
| InChI | InChI=1S/C21H32O9/c22-12-17-18(23)20(19(24)21(25)30-17)27-10-6-4-2-1-3-5-9-26-14-7-8-15-16(11-14)29-13-28-15/h7-8,11,17-25H,1-6,9-10,12-13H2/t17-,18-,19-,20+,21?/m1/s1 |
| InChIKey | LZFNAGZZDYLIOJ-APISQKPESA-N |
| XLogP | 0.95 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|