C24H35NO7 — CID 166703720
(2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(9-quinolin-6-yloxynonoxy)oxane-2,4,5-triol (PubChem CID 166703720) has the molecular formula C24H35NO7 and a molecular weight of 449.54 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(9-quinolin-6-yloxynonoxy)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(9-quinolin-6-yloxynonoxy)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 166703720 |
| Molecular Formula | C24H35NO7 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(hydroxymethyl)-3-(9-quinolin-6-yloxynonoxy)oxane-2,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](O)[C@H](OCCCCCCCCCOc2ccc3ncccc3c2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C24H35NO7/c26-16-20-21(27)22(28)23(24(29)32-20)31-14-7-5-3-1-2-4-6-13-30-18-10-11-19-17(15-18)9-8-12-25-19/h8-12,15,20-24,26-29H,1-7,13-14,16H2/t20-,21-,22+,23-,24-/m1/s1 |
| InChIKey | KBLSOKYSWBEENR-GNADVCDUSA-N |
| XLogP | 2.16 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|