C23H33NO7 — CID 166517546
(2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-(8-quinolin-6-yloxyoctoxy)hexanal (PubChem CID 166517546) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-(8-quinolin-6-yloxyoctoxy)hexanal.
| Compound Name | (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-(8-quinolin-6-yloxyoctoxy)hexanal |
|---|---|
| PubChem CID | 166517546 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | (2R,3S,4R,5R)-2,4,5,6-tetrahydroxy-3-(8-quinolin-6-yloxyoctoxy)hexanal |
| SMILES | O=C[C@H](O)[C@@H](OCCCCCCCCOc1ccc2ncccc2c1)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H33NO7/c25-15-20(27)22(29)23(21(28)16-26)31-13-6-4-2-1-3-5-12-30-18-9-10-19-17(14-18)8-7-11-24-19/h7-11,14,16,20-23,25,27-29H,1-6,12-13,15H2/t20-,21+,22-,23-/m1/s1 |
| InChIKey | XLWPCNWINDKSCB-KAOXLYBCSA-N |
| XLogP | 1.61 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|