C25H37NO7 — CID 166517573
(3R,4S,5R,6R)-6-(hydroxymethyl)-4-(10-quinolin-6-yloxydecoxy)oxane-2,3,5-triol (PubChem CID 166517573) has the molecular formula C25H37NO7 and a molecular weight of 463.57 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-(hydroxymethyl)-4-(10-quinolin-6-yloxydecoxy)oxane-2,3,5-triol.
| Compound Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-4-(10-quinolin-6-yloxydecoxy)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 166517573 |
| Molecular Formula | C25H37NO7 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | (3R,4S,5R,6R)-6-(hydroxymethyl)-4-(10-quinolin-6-yloxydecoxy)oxane-2,3,5-triol |
| SMILES | OC[C@H]1OC(O)[C@H](O)[C@@H](OCCCCCCCCCCOc2ccc3ncccc3c2)[C@@H]1O |
| InChI | InChI=1S/C25H37NO7/c27-17-21-22(28)24(23(29)25(30)33-21)32-15-8-6-4-2-1-3-5-7-14-31-19-11-12-20-18(16-19)10-9-13-26-20/h9-13,16,21-25,27-30H,1-8,14-15,17H2/t21-,22-,23-,24+,25?/m1/s1 |
| InChIKey | NIKMWCLTUWGZDJ-CHJXOBGISA-N |
| XLogP | 2.55 |
| TPSA | 121.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|