C16H19NO5 — CID 157081805
(3R,4R,6S)-2-(hydroxymethyl)-5-methyl-6-quinolin-7-yloxyoxane-3,4-diol (PubChem CID 157081805) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is (3R,4R,6S)-2-(hydroxymethyl)-5-methyl-6-quinolin-7-yloxyoxane-3,4-diol.
| Compound Name | (3R,4R,6S)-2-(hydroxymethyl)-5-methyl-6-quinolin-7-yloxyoxane-3,4-diol |
|---|---|
| PubChem CID | 157081805 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | (3R,4R,6S)-2-(hydroxymethyl)-5-methyl-6-quinolin-7-yloxyoxane-3,4-diol |
| SMILES | CC1[C@H](Oc2ccc3cccnc3c2)OC(CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19NO5/c1-9-14(19)15(20)13(8-18)22-16(9)21-11-5-4-10-3-2-6-17-12(10)7-11/h2-7,9,13-16,18-20H,8H2,1H3/t9?,13?,14-,15+,16-/m1/s1 |
| InChIKey | ADQCPKBYLAJWPY-DPIIGHLBSA-N |
| XLogP | 0.69 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |