C12H19IN2O2 — CID 2280836
N'-[2-[2-(4-iodophenoxy)ethoxy]ethyl]ethane-1,2-diamine (PubChem CID 2280836) has the molecular formula C12H19IN2O2 and a molecular weight of 350.20 g/mol. Its IUPAC name is N'-[2-[2-(4-iodophenoxy)ethoxy]ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[2-(4-iodophenoxy)ethoxy]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 2280836 |
| Molecular Formula | C12H19IN2O2 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | N'-[2-[2-(4-iodophenoxy)ethoxy]ethyl]ethane-1,2-diamine |
| SMILES | NCCNCCOCCOc1ccc(I)cc1 |
| InChI | InChI=1S/C12H19IN2O2/c13-11-1-3-12(4-2-11)17-10-9-16-8-7-15-6-5-14/h1-4,15H,5-10,14H2 |
| InChIKey | LHTNVZFBDODJFQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|