C21H19ClN2O4 — CID 22872431
(1R)-1-(3-chlorophenyl)-2-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]ethanol (PubChem CID 22872431) has the molecular formula C21H19ClN2O4 and a molecular weight of 398.85 g/mol. Its IUPAC name is (1R)-1-(3-chlorophenyl)-2-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]ethanol.
| Compound Name | (1R)-1-(3-chlorophenyl)-2-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]ethanol |
|---|---|
| PubChem CID | 22872431 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (1R)-1-(3-chlorophenyl)-2-[2-[[2-(1,2-oxazol-3-yl)-1-benzofuran-5-yl]oxy]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCOc1ccc2oc(-c3ccon3)cc2c1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19ClN2O4/c22-16-3-1-2-14(10-16)19(25)13-23-7-9-26-17-4-5-20-15(11-17)12-21(28-20)18-6-8-27-24-18/h1-6,8,10-12,19,23,25H,7,9,13H2/t19-/m0/s1 |
| InChIKey | NPDDLHNYCSGLCK-IBGZPJMESA-N |
| XLogP | 4.44 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|