C20H20ClNO5 — CID 139694909
methyl 5-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]-1-benzofuran-2-carboxylate (PubChem CID 139694909) has the molecular formula C20H20ClNO5 and a molecular weight of 389.84 g/mol. Its IUPAC name is methyl 5-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]-1-benzofuran-2-carboxylate.
| Compound Name | methyl 5-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 139694909 |
| Molecular Formula | C20H20ClNO5 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | methyl 5-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]-1-benzofuran-2-carboxylate |
| SMILES | COC(=O)c1cc2cc(OCCNC[C@H](O)c3cccc(Cl)c3)ccc2o1 |
| InChI | InChI=1S/C20H20ClNO5/c1-25-20(24)19-11-14-10-16(5-6-18(14)27-19)26-8-7-22-12-17(23)13-3-2-4-15(21)9-13/h2-6,9-11,17,22-23H,7-8,12H2,1H3/t17-/m0/s1 |
| InChIKey | DGYWKNWPYHEDCX-KRWDZBQOSA-N |
| XLogP | 3.57 |
| TPSA | 80.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|