About phenylmethanesulfonamide;sulfuryl dichloride
phenylmethanesulfonamide;sulfuryl dichloride (PubChem CID 174345826) has the molecular formula C7H9Cl2NO4S2
and a molecular weight of 306.19 g/mol. Its IUPAC name is phenylmethanesulfonamide;sulfuryl dichloride.
Molecular Properties
| Compound Name | phenylmethanesulfonamide;sulfuryl dichloride |
| PubChem CID | 174345826 |
| Molecular Formula | C7H9Cl2NO4S2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 304.94 |
| IUPAC Name | phenylmethanesulfonamide;sulfuryl dichloride |
| SMILES | NS(=O)(=O)Cc1ccccc1.O=S(=O)(Cl)Cl |
| InChI | InChI=1S/C7H9NO2S.Cl2O2S/c8-11(9,10)6-7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6H2,(H2,8,9,10); |
| InChIKey | GBYJNOQZDHDYOB-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenylmethanesulfonamide;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanesulfonamide;sulfuryl dichloride?
The IUPAC name of phenylmethanesulfonamide;sulfuryl dichloride (CID 174345826) is phenylmethanesulfonamide;sulfuryl dichloride.
What is the SMILES notation for phenylmethanesulfonamide;sulfuryl dichloride?
The canonical SMILES for phenylmethanesulfonamide;sulfuryl dichloride is NS(=O)(=O)Cc1ccccc1.O=S(=O)(Cl)Cl.
What is the InChIKey of phenylmethanesulfonamide;sulfuryl dichloride?
The InChIKey is GBYJNOQZDHDYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.Cl2O2S/c8-11(9,10)6-7-4-2-1-3-5-7;1-5(2,3)4/h1-5H,6H2,(H2,8,9,10);.
What are the key properties of phenylmethanesulfonamide;sulfuryl dichloride?
phenylmethanesulfonamide;sulfuryl dichloride has a molecular weight of 306.19 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanesulfonamide;sulfuryl dichloride is sourced from PubChem (CID 174345826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).