C14H20ClN3S2 — CID 62766999
N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 62766999) has the molecular formula C14H20ClN3S2 and a molecular weight of 329.92 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62766999 |
| Molecular Formula | C14H20ClN3S2 |
| Molecular Weight | 329.92 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)Cc2ccc(Cl)s2)nc1C |
| InChI | InChI=1S/C14H20ClN3S2/c1-4-7-16-8-12-10(2)17-14(20-12)18(3)9-11-5-6-13(15)19-11/h5-6,16H,4,7-9H2,1-3H3 |
| InChIKey | GGROULZSOKQZSO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.92 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|