C14H20BrN3S2 — CID 62767191
N-[(4-bromothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 62767191) has the molecular formula C14H20BrN3S2 and a molecular weight of 374.37 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62767191 |
| Molecular Formula | C14H20BrN3S2 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-N,4-dimethyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)Cc2cc(Br)cs2)nc1C |
| InChI | InChI=1S/C14H20BrN3S2/c1-4-5-16-7-13-10(2)17-14(20-13)18(3)8-12-6-11(15)9-19-12/h6,9,16H,4-5,7-8H2,1-3H3 |
| InChIKey | HOCKCLRSTUTPQR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|