C16H20BrFN2S — CID 63552121
N-[(4-bromothiophen-2-yl)methyl]-4-fluoro-N-methyl-2-(propylaminomethyl)aniline (PubChem CID 63552121) has the molecular formula C16H20BrFN2S and a molecular weight of 371.32 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4-fluoro-N-methyl-2-(propylaminomethyl)aniline.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4-fluoro-N-methyl-2-(propylaminomethyl)aniline |
|---|---|
| PubChem CID | 63552121 |
| Molecular Formula | C16H20BrFN2S |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4-fluoro-N-methyl-2-(propylaminomethyl)aniline |
| SMILES | CCCNCc1cc(F)ccc1N(C)Cc1cc(Br)cs1 |
| InChI | InChI=1S/C16H20BrFN2S/c1-3-6-19-9-12-7-14(18)4-5-16(12)20(2)10-15-8-13(17)11-21-15/h4-5,7-8,11,19H,3,6,9-10H2,1-2H3 |
| InChIKey | SBWAWEDMIUFVDS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|