C14H16BrFN2S — CID 54984847
N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methyl-4-(methylaminomethyl)aniline (PubChem CID 54984847) has the molecular formula C14H16BrFN2S and a molecular weight of 343.27 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methyl-4-(methylaminomethyl)aniline.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methyl-4-(methylaminomethyl)aniline |
|---|---|
| PubChem CID | 54984847 |
| Molecular Formula | C14H16BrFN2S |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methyl-4-(methylaminomethyl)aniline |
| SMILES | CNCc1ccc(N(C)Cc2cc(Br)cs2)c(F)c1 |
| InChI | InChI=1S/C14H16BrFN2S/c1-17-7-10-3-4-14(13(16)5-10)18(2)8-12-6-11(15)9-19-12/h3-6,9,17H,7-8H2,1-2H3 |
| InChIKey | VPUZDIGKYXSNEQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|