C14H16BrFN2S — CID 54984893
4-(1-aminoethyl)-N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methylaniline (PubChem CID 54984893) has the molecular formula C14H16BrFN2S and a molecular weight of 343.27 g/mol. Its IUPAC name is 4-(1-aminoethyl)-N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methylaniline.
| Compound Name | 4-(1-aminoethyl)-N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 54984893 |
| Molecular Formula | C14H16BrFN2S |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 4-(1-aminoethyl)-N-[(4-bromothiophen-2-yl)methyl]-2-fluoro-N-methylaniline |
| SMILES | CC(N)c1ccc(N(C)Cc2cc(Br)cs2)c(F)c1 |
| InChI | InChI=1S/C14H16BrFN2S/c1-9(17)10-3-4-14(13(16)5-10)18(2)7-12-6-11(15)8-19-12/h3-6,8-9H,7,17H2,1-2H3 |
| InChIKey | JLKBSDJVTZFEPZ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |