C15H19FN2O — CID 78934703
4-[(1S)-1-aminoethyl]-2-fluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]aniline (PubChem CID 78934703) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-2-fluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]aniline.
| Compound Name | 4-[(1S)-1-aminoethyl]-2-fluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]aniline |
|---|---|
| PubChem CID | 78934703 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-2-fluoro-N-methyl-N-[(2-methylfuran-3-yl)methyl]aniline |
| SMILES | Cc1occc1CN(C)c1ccc([C@H](C)N)cc1F |
| InChI | InChI=1S/C15H19FN2O/c1-10(17)12-4-5-15(14(16)8-12)18(3)9-13-6-7-19-11(13)2/h4-8,10H,9,17H2,1-3H3/t10-/m0/s1 |
| InChIKey | YRYIHEQFQONJLO-JTQLQIEISA-N |
| XLogP | 3.38 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |