C15H29N3S — CID 55117328
N,4-dimethyl-N-(4-methylpentan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 55117328) has the molecular formula C15H29N3S and a molecular weight of 283.48 g/mol. Its IUPAC name is N,4-dimethyl-N-(4-methylpentan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N,4-dimethyl-N-(4-methylpentan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 55117328 |
| Molecular Formula | C15H29N3S |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | N,4-dimethyl-N-(4-methylpentan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)C(C)CC(C)C)nc1C |
| InChI | InChI=1S/C15H29N3S/c1-7-8-16-10-14-13(5)17-15(19-14)18(6)12(4)9-11(2)3/h11-12,16H,7-10H2,1-6H3 |
| InChIKey | RWUHCAGZLPLQRV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|