C15H22ClN3S2 — CID 62767520
N-[(5-chlorothiophen-2-yl)methyl]-4-ethyl-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 62767520) has the molecular formula C15H22ClN3S2 and a molecular weight of 343.95 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-ethyl-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-ethyl-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62767520 |
| Molecular Formula | C15H22ClN3S2 |
| Molecular Weight | 343.95 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-ethyl-N-methyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)Cc2ccc(Cl)s2)nc1CC |
| InChI | InChI=1S/C15H22ClN3S2/c1-4-8-17-9-13-12(5-2)18-15(21-13)19(3)10-11-6-7-14(16)20-11/h6-7,17H,4-5,8-10H2,1-3H3 |
| InChIKey | ZIVFIIFJANXTRU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|