C16H25N3S2 — CID 62767058
N,4-diethyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 62767058) has the molecular formula C16H25N3S2 and a molecular weight of 323.53 g/mol. Its IUPAC name is N,4-diethyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | N,4-diethyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62767058 |
| Molecular Formula | C16H25N3S2 |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N,4-diethyl-5-(propylaminomethyl)-N-(thiophen-2-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(CC)Cc2cccs2)nc1CC |
| InChI | InChI=1S/C16H25N3S2/c1-4-9-17-11-15-14(5-2)18-16(21-15)19(6-3)12-13-8-7-10-20-13/h7-8,10,17H,4-6,9,11-12H2,1-3H3 |
| InChIKey | LGEGTMCSZYLODT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|