C14H28N4S — CID 63725686
N'-[4-ethyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 63725686) has the molecular formula C14H28N4S and a molecular weight of 284.47 g/mol. Its IUPAC name is N'-[4-ethyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-[4-ethyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 63725686 |
| Molecular Formula | C14H28N4S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N'-[4-ethyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CCCNCc1sc(N(C)CCN(C)C)nc1CC |
| InChI | InChI=1S/C14H28N4S/c1-6-8-15-11-13-12(7-2)16-14(19-13)18(5)10-9-17(3)4/h15H,6-11H2,1-5H3 |
| InChIKey | ZVIGQMJYLOAULZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|