C15H29N3S2 — CID 115987962
4-ethyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 115987962) has the molecular formula C15H29N3S2 and a molecular weight of 315.55 g/mol. Its IUPAC name is 4-ethyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-ethyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115987962 |
| Molecular Formula | C15H29N3S2 |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 4-ethyl-N-methyl-N-(1-methylsulfanylbutan-2-yl)-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)C(CC)CSC)nc1CC |
| InChI | InChI=1S/C15H29N3S2/c1-6-9-16-10-14-13(8-3)17-15(20-14)18(4)12(7-2)11-19-5/h12,16H,6-11H2,1-5H3 |
| InChIKey | CEJCIXRYGSLGLF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|