C16H31N3S2 — CID 115987957
N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-amine (PubChem CID 115987957) has the molecular formula C16H31N3S2 and a molecular weight of 329.58 g/mol. Its IUPAC name is N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-amine.
| Compound Name | N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 115987957 |
| Molecular Formula | C16H31N3S2 |
| Molecular Weight | 329.58 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | N-methyl-N-(1-methylsulfanylbutan-2-yl)-4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-amine |
| SMILES | CCCNCc1sc(N(C)C(CC)CSC)nc1CCC |
| InChI | InChI=1S/C16H31N3S2/c1-6-9-14-15(11-17-10-7-2)21-16(18-14)19(4)13(8-3)12-20-5/h13,17H,6-12H2,1-5H3 |
| InChIKey | HBPJKEGAEVIUEW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|