C15H30N4S — CID 63727753
N,N,N'-trimethyl-N'-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine (PubChem CID 63727753) has the molecular formula C15H30N4S and a molecular weight of 298.50 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 63727753 |
| Molecular Formula | C15H30N4S |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | N,N,N'-trimethyl-N'-[4-propyl-5-(propylaminomethyl)-1,3-thiazol-2-yl]ethane-1,2-diamine |
| SMILES | CCCNCc1sc(N(C)CCN(C)C)nc1CCC |
| InChI | InChI=1S/C15H30N4S/c1-6-8-13-14(12-16-9-7-2)20-15(17-13)19(5)11-10-18(3)4/h16H,6-12H2,1-5H3 |
| InChIKey | IINSMDBYDIPDLR-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|