C14H13Cl2NO2S — CID 102669868
3-chloro-4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid (PubChem CID 102669868) has the molecular formula C14H13Cl2NO2S and a molecular weight of 330.24 g/mol. Its IUPAC name is 3-chloro-4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid.
| Compound Name | 3-chloro-4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 102669868 |
| Molecular Formula | C14H13Cl2NO2S |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 3-chloro-4-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(Cl)s1)Cc1ccc(C(=O)O)cc1Cl |
| InChI | InChI=1S/C14H13Cl2NO2S/c1-17(8-11-4-5-13(16)20-11)7-10-3-2-9(14(18)19)6-12(10)15/h2-6H,7-8H2,1H3,(H,18,19) |
| InChIKey | UKIMDIQVOPJOLA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |