C14H15ClN2O2S — CID 104824459
2-amino-6-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid (PubChem CID 104824459) has the molecular formula C14H15ClN2O2S and a molecular weight of 310.81 g/mol. Its IUPAC name is 2-amino-6-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid.
| Compound Name | 2-amino-6-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 104824459 |
| Molecular Formula | C14H15ClN2O2S |
| Molecular Weight | 310.81 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-amino-6-[[(5-chlorothiophen-2-yl)methyl-methylamino]methyl]benzoic acid |
| SMILES | CN(Cc1ccc(Cl)s1)Cc1cccc(N)c1C(=O)O |
| InChI | InChI=1S/C14H15ClN2O2S/c1-17(8-10-5-6-12(15)20-10)7-9-3-2-4-11(16)13(9)14(18)19/h2-6H,7-8,16H2,1H3,(H,18,19) |
| InChIKey | YLBIEKMJMPEKER-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.81 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|