C11H24ClF3N2 — CID 115607183
N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine;hydrochloride (PubChem CID 115607183) has the molecular formula C11H24ClF3N2 and a molecular weight of 276.77 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine;hydrochloride.
| Compound Name | N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 115607183 |
| Molecular Formula | C11H24ClF3N2 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N'-methyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine;hydrochloride |
| SMILES | CN(CCCNCC(C)(C)C)CC(F)(F)F.Cl |
| InChI | InChI=1S/C11H23F3N2.ClH/c1-10(2,3)8-15-6-5-7-16(4)9-11(12,13)14;/h15H,5-9H2,1-4H3;1H |
| InChIKey | OOPTULLSZAOLFL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|