C27H56N2 — CID 162282257
N-(2,2-dimethylpropyl)-N,6-dimethylhept-4-en-1-amine;N-(2,2-dimethylpropyl)-6-methylhept-4-en-1-amine (PubChem CID 162282257) has the molecular formula C27H56N2 and a molecular weight of 408.76 g/mol. Its IUPAC name is N-(2,2-dimethylpropyl)-N,6-dimethylhept-4-en-1-amine;N-(2,2-dimethylpropyl)-6-methylhept-4-en-1-amine.
| Compound Name | N-(2,2-dimethylpropyl)-N,6-dimethylhept-4-en-1-amine;N-(2,2-dimethylpropyl)-6-methylhept-4-en-1-amine |
|---|---|
| PubChem CID | 162282257 |
| Molecular Formula | C27H56N2 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 408.44 |
| IUPAC Name | N-(2,2-dimethylpropyl)-N,6-dimethylhept-4-en-1-amine;N-(2,2-dimethylpropyl)-6-methylhept-4-en-1-amine |
| SMILES | CC(C)C=CCCCN(C)CC(C)(C)C.CC(C)C=CCCCNCC(C)(C)C |
| InChI | InChI=1S/C14H29N.C13H27N/c1-13(2)10-8-7-9-11-15(6)12-14(3,4)5;1-12(2)9-7-6-8-10-14-11-13(3,4)5/h8,10,13H,7,9,11-12H2,1-6H3;7,9,12,14H,6,8,10-11H2,1-5H3 |
| InChIKey | KZOZNRWIAFKDSR-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|