C16H23F3N2 — CID 119108037
N'-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 119108037) has the molecular formula C16H23F3N2 and a molecular weight of 300.37 g/mol. Its IUPAC name is N'-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 119108037 |
| Molecular Formula | C16H23F3N2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N'-methyl-N-[(E)-2-methyl-3-phenylprop-2-enyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | C/C(=C\c1ccccc1)CNCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C16H23F3N2/c1-14(11-15-7-4-3-5-8-15)12-20-9-6-10-21(2)13-16(17,18)19/h3-5,7-8,11,20H,6,9-10,12-13H2,1-2H3/b14-11+ |
| InChIKey | AIIHJPLLBRQGER-SDNWHVSQSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|