C11H26N2S2 — CID 10428904
2-methyl-1-[2-[methyl-(2-methyl-2-sulfanylpropyl)amino]ethylamino]propane-2-thiol (PubChem CID 10428904) has the molecular formula C11H26N2S2 and a molecular weight of 250.48 g/mol. Its IUPAC name is 2-methyl-1-[2-[methyl-(2-methyl-2-sulfanylpropyl)amino]ethylamino]propane-2-thiol.
| Compound Name | 2-methyl-1-[2-[methyl-(2-methyl-2-sulfanylpropyl)amino]ethylamino]propane-2-thiol |
|---|---|
| PubChem CID | 10428904 |
| Molecular Formula | C11H26N2S2 |
| Molecular Weight | 250.48 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2-methyl-1-[2-[methyl-(2-methyl-2-sulfanylpropyl)amino]ethylamino]propane-2-thiol |
| SMILES | CN(CCNCC(C)(C)S)CC(C)(C)S |
| InChI | InChI=1S/C11H26N2S2/c1-10(2,14)8-12-6-7-13(5)9-11(3,4)15/h12,14-15H,6-9H2,1-5H3 |
| InChIKey | AMEVWSYYLMKUPL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|