C13H16F6N2 — CID 130272670
N'-methyl-N'-(2,2,2-trifluoroethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine (PubChem CID 130272670) has the molecular formula C13H16F6N2 and a molecular weight of 314.27 g/mol. Its IUPAC name is N'-methyl-N'-(2,2,2-trifluoroethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-methyl-N'-(2,2,2-trifluoroethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 130272670 |
| Molecular Formula | C13H16F6N2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N'-methyl-N'-(2,2,2-trifluoroethyl)-N-[[2-(trifluoromethyl)phenyl]methyl]ethane-1,2-diamine |
| SMILES | CN(CCNCc1ccccc1C(F)(F)F)CC(F)(F)F |
| InChI | InChI=1S/C13H16F6N2/c1-21(9-12(14,15)16)7-6-20-8-10-4-2-3-5-11(10)13(17,18)19/h2-5,20H,6-9H2,1H3 |
| InChIKey | TXDVDFDLTVRPCT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|