C16H21F3N2O — CID 119111480
N'-methyl-N-[(2-prop-2-ynoxyphenyl)methyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 119111480) has the molecular formula C16H21F3N2O and a molecular weight of 314.35 g/mol. Its IUPAC name is N'-methyl-N-[(2-prop-2-ynoxyphenyl)methyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | N'-methyl-N-[(2-prop-2-ynoxyphenyl)methyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 119111480 |
| Molecular Formula | C16H21F3N2O |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N'-methyl-N-[(2-prop-2-ynoxyphenyl)methyl]-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | C#CCOc1ccccc1CNCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O/c1-3-11-22-15-8-5-4-7-14(15)12-20-9-6-10-21(2)13-16(17,18)19/h1,4-5,7-8,20H,6,9-13H2,2H3 |
| InChIKey | HMWXHIUDYBBMJU-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|