C17H23NO — CID 60733626
2-cyclopentyl-N-[(2-prop-2-ynoxyphenyl)methyl]ethanamine (PubChem CID 60733626) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(2-prop-2-ynoxyphenyl)methyl]ethanamine.
| Compound Name | 2-cyclopentyl-N-[(2-prop-2-ynoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 60733626 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 2-cyclopentyl-N-[(2-prop-2-ynoxyphenyl)methyl]ethanamine |
| SMILES | C#CCOc1ccccc1CNCCC1CCCC1 |
| InChI | InChI=1S/C17H23NO/c1-2-13-19-17-10-6-5-9-16(17)14-18-12-11-15-7-3-4-8-15/h1,5-6,9-10,15,18H,3-4,7-8,11-14H2 |
| InChIKey | MIUWHIDKYZQMOM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|