C17H21NO — CID 28661521
1,1-dicyclopropyl-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine (PubChem CID 28661521) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 1,1-dicyclopropyl-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine.
| Compound Name | 1,1-dicyclopropyl-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine |
|---|---|
| PubChem CID | 28661521 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1,1-dicyclopropyl-N-[(2-prop-2-ynoxyphenyl)methyl]methanamine |
| SMILES | C#CCOc1ccccc1CNC(C1CC1)C1CC1 |
| InChI | InChI=1S/C17H21NO/c1-2-11-19-16-6-4-3-5-15(16)12-18-17(13-7-8-13)14-9-10-14/h1,3-6,13-14,17-18H,7-12H2 |
| InChIKey | DTXAYNGMAIEUSR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|